C14H9Cl2FN2O4S2 — CID 175760561
2-[(3,4-dichloro-1H-indol-7-yl)sulfamoyl]benzenesulfonyl fluoride (PubChem CID 175760561) has the molecular formula C14H9Cl2FN2O4S2 and a molecular weight of 423.27 g/mol. Its IUPAC name is 2-[(3,4-dichloro-1H-indol-7-yl)sulfamoyl]benzenesulfonyl fluoride.
| Compound Name | 2-[(3,4-dichloro-1H-indol-7-yl)sulfamoyl]benzenesulfonyl fluoride |
|---|---|
| PubChem CID | 175760561 |
| Molecular Formula | C14H9Cl2FN2O4S2 |
| Molecular Weight | 423.27 g/mol |
| Exact Mass | 421.94 |
| IUPAC Name | 2-[(3,4-dichloro-1H-indol-7-yl)sulfamoyl]benzenesulfonyl fluoride |
| SMILES | O=S(=O)(F)c1ccccc1S(=O)(=O)Nc1ccc(Cl)c2c(Cl)c[nH]c12 |
| InChI | InChI=1S/C14H9Cl2FN2O4S2/c15-8-5-6-10(14-13(8)9(16)7-18-14)19-25(22,23)12-4-2-1-3-11(12)24(17,20)21/h1-7,18-19H |
| InChIKey | LAGSVRLHSCIIQC-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 96.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.27 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |