About 2-[(3,4-dichloro-1H-indol-7-yl)sulfamoyl]benzenesulfonyl fluoride
2-[(3,4-dichloro-1H-indol-7-yl)sulfamoyl]benzenesulfonyl fluoride (PubChem CID 175760561) has the molecular formula C14H9Cl2FN2O4S2
and a molecular weight of 423.27 g/mol. Its IUPAC name is 2-[(3,4-dichloro-1H-indol-7-yl)sulfamoyl]benzenesulfonyl fluoride.
Molecular Properties
| Compound Name | 2-[(3,4-dichloro-1H-indol-7-yl)sulfamoyl]benzenesulfonyl fluoride |
| PubChem CID | 175760561 |
| Molecular Formula | C14H9Cl2FN2O4S2 |
| Molecular Weight | 423.27 g/mol |
| Exact Mass | 421.94 |
| IUPAC Name | 2-[(3,4-dichloro-1H-indol-7-yl)sulfamoyl]benzenesulfonyl fluoride |
| SMILES | O=S(=O)(F)c1ccccc1S(=O)(=O)Nc1ccc(Cl)c2c(Cl)c[nH]c12 |
| InChI | InChI=1S/C14H9Cl2FN2O4S2/c15-8-5-6-10(14-13(8)9(16)7-18-14)19-25(22,23)12-4-2-1-3-11(12)24(17,20)21/h1-7,18-19H |
| InChIKey | LAGSVRLHSCIIQC-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 96.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 423.27 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-[(3,4-dichloro-1H-indol-7-yl)sulfamoyl]benzenesulfonyl fluoride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(3,4-dichloro-1H-indol-7-yl)sulfamoyl]benzenesulfonyl fluoride?
The IUPAC name of 2-[(3,4-dichloro-1H-indol-7-yl)sulfamoyl]benzenesulfonyl fluoride (CID 175760561) is 2-[(3,4-dichloro-1H-indol-7-yl)sulfamoyl]benzenesulfonyl fluoride.
What is the SMILES notation for 2-[(3,4-dichloro-1H-indol-7-yl)sulfamoyl]benzenesulfonyl fluoride?
The canonical SMILES for 2-[(3,4-dichloro-1H-indol-7-yl)sulfamoyl]benzenesulfonyl fluoride is O=S(=O)(F)c1ccccc1S(=O)(=O)Nc1ccc(Cl)c2c(Cl)c[nH]c12.
What is the InChIKey of 2-[(3,4-dichloro-1H-indol-7-yl)sulfamoyl]benzenesulfonyl fluoride?
The InChIKey is LAGSVRLHSCIIQC-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H9Cl2FN2O4S2/c15-8-5-6-10(14-13(8)9(16)7-18-14)19-25(22,23)12-4-2-1-3-11(12)24(17,20)21/h1-7,18-19H.
What are the key properties of 2-[(3,4-dichloro-1H-indol-7-yl)sulfamoyl]benzenesulfonyl fluoride?
2-[(3,4-dichloro-1H-indol-7-yl)sulfamoyl]benzenesulfonyl fluoride has a molecular weight of 423.27 g/mol, XLogP of 3.93, 4 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(3,4-dichloro-1H-indol-7-yl)sulfamoyl]benzenesulfonyl fluoride is sourced from PubChem (CID 175760561), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).