C17H15Cl2FN2O4S — CID 164877611
3-[(3,4-dichloro-1H-indol-7-yl)sulfamoyl]-2-fluorobenzoic acid;ethane (PubChem CID 164877611) has the molecular formula C17H15Cl2FN2O4S and a molecular weight of 433.29 g/mol. Its IUPAC name is 3-[(3,4-dichloro-1H-indol-7-yl)sulfamoyl]-2-fluorobenzoic acid;ethane.
| Compound Name | 3-[(3,4-dichloro-1H-indol-7-yl)sulfamoyl]-2-fluorobenzoic acid;ethane |
|---|---|
| PubChem CID | 164877611 |
| Molecular Formula | C17H15Cl2FN2O4S |
| Molecular Weight | 433.29 g/mol |
| Exact Mass | 432.01 |
| IUPAC Name | 3-[(3,4-dichloro-1H-indol-7-yl)sulfamoyl]-2-fluorobenzoic acid;ethane |
| SMILES | CC.O=C(O)c1cccc(S(=O)(=O)Nc2ccc(Cl)c3c(Cl)c[nH]c23)c1F |
| InChI | InChI=1S/C15H9Cl2FN2O4S.C2H6/c16-8-4-5-10(14-12(8)9(17)6-19-14)20-25(23,24)11-3-1-2-7(13(11)18)15(21)22;1-2/h1-6,19-20H,(H,21,22);1-2H3 |
| InChIKey | GTXAGQOAMGUBKP-UHFFFAOYSA-N |
| XLogP | 5.14 |
| TPSA | 99.26 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.29 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |