C14H11Cl2N3O4S2 — CID 22228546
4-N-(3,4-dichloro-1H-indol-7-yl)benzene-1,4-disulfonamide (PubChem CID 22228546) has the molecular formula C14H11Cl2N3O4S2 and a molecular weight of 420.30 g/mol. Its IUPAC name is 4-N-(3,4-dichloro-1H-indol-7-yl)benzene-1,4-disulfonamide.
| Compound Name | 4-N-(3,4-dichloro-1H-indol-7-yl)benzene-1,4-disulfonamide |
|---|---|
| PubChem CID | 22228546 |
| Molecular Formula | C14H11Cl2N3O4S2 |
| Molecular Weight | 420.30 g/mol |
| Exact Mass | 418.96 |
| IUPAC Name | 4-N-(3,4-dichloro-1H-indol-7-yl)benzene-1,4-disulfonamide |
| SMILES | NS(=O)(=O)c1ccc(S(=O)(=O)Nc2ccc(Cl)c3c(Cl)c[nH]c23)cc1 |
| InChI | InChI=1S/C14H11Cl2N3O4S2/c15-10-5-6-12(14-13(10)11(16)7-18-14)19-25(22,23)9-3-1-8(2-4-9)24(17,20)21/h1-7,18-19H,(H2,17,20,21) |
| InChIKey | AGOZRYFXJPSNFK-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 122.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.30 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |