C15H9Cl2N3O2S — CID 164863478
3-cyano-N-(3,4-dichloro-1H-indol-7-yl)benzenesulfonamide (PubChem CID 164863478) has the molecular formula C15H9Cl2N3O2S and a molecular weight of 366.23 g/mol. Its IUPAC name is 3-cyano-N-(3,4-dichloro-1H-indol-7-yl)benzenesulfonamide.
| Compound Name | 3-cyano-N-(3,4-dichloro-1H-indol-7-yl)benzenesulfonamide |
|---|---|
| PubChem CID | 164863478 |
| Molecular Formula | C15H9Cl2N3O2S |
| Molecular Weight | 366.23 g/mol |
| Exact Mass | 364.98 |
| IUPAC Name | 3-cyano-N-(3,4-dichloro-1H-indol-7-yl)benzenesulfonamide |
| SMILES | N#Cc1cccc(S(=O)(=O)Nc2ccc(Cl)c3c(Cl)c[nH]c23)c1 |
| InChI | InChI=1S/C15H9Cl2N3O2S/c16-11-4-5-13(15-14(11)12(17)8-19-15)20-23(21,22)10-3-1-2-9(6-10)7-18/h1-6,8,19-20H |
| InChIKey | PJVXGBPECHZEBC-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 85.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.23 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |