C15H11ClN4O2S — CID 11175421
4-amino-N-(3-chloro-4-cyano-1H-indol-7-yl)benzenesulfonamide (PubChem CID 11175421) has the molecular formula C15H11ClN4O2S and a molecular weight of 346.80 g/mol. Its IUPAC name is 4-amino-N-(3-chloro-4-cyano-1H-indol-7-yl)benzenesulfonamide.
| Compound Name | 4-amino-N-(3-chloro-4-cyano-1H-indol-7-yl)benzenesulfonamide |
|---|---|
| PubChem CID | 11175421 |
| Molecular Formula | C15H11ClN4O2S |
| Molecular Weight | 346.80 g/mol |
| Exact Mass | 346.03 |
| IUPAC Name | 4-amino-N-(3-chloro-4-cyano-1H-indol-7-yl)benzenesulfonamide |
| SMILES | N#Cc1ccc(NS(=O)(=O)c2ccc(N)cc2)c2[nH]cc(Cl)c12 |
| InChI | InChI=1S/C15H11ClN4O2S/c16-12-8-19-15-13(6-1-9(7-17)14(12)15)20-23(21,22)11-4-2-10(18)3-5-11/h1-6,8,19-20H,18H2 |
| InChIKey | RMLUYLSVKDNTTJ-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 111.77 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.80 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|