C30H32Cl2FN3O3S — CID 164877449
3-[4-(1-benzylpiperidin-4-yl)butoxy]-N-(3,4-dichloro-1H-indol-7-yl)-2-fluorobenzenesulfonamide (PubChem CID 164877449) has the molecular formula C30H32Cl2FN3O3S and a molecular weight of 604.58 g/mol. Its IUPAC name is 3-[4-(1-benzylpiperidin-4-yl)butoxy]-N-(3,4-dichloro-1H-indol-7-yl)-2-fluorobenzenesulfonamide.
| Compound Name | 3-[4-(1-benzylpiperidin-4-yl)butoxy]-N-(3,4-dichloro-1H-indol-7-yl)-2-fluorobenzenesulfonamide |
|---|---|
| PubChem CID | 164877449 |
| Molecular Formula | C30H32Cl2FN3O3S |
| Molecular Weight | 604.58 g/mol |
| Exact Mass | 603.15 |
| IUPAC Name | 3-[4-(1-benzylpiperidin-4-yl)butoxy]-N-(3,4-dichloro-1H-indol-7-yl)-2-fluorobenzenesulfonamide |
| SMILES | O=S(=O)(Nc1ccc(Cl)c2c(Cl)c[nH]c12)c1cccc(OCCCCC2CCN(Cc3ccccc3)CC2)c1F |
| InChI | InChI=1S/C30H32Cl2FN3O3S/c31-23-12-13-25(30-28(23)24(32)19-34-30)35-40(37,38)27-11-6-10-26(29(27)33)39-18-5-4-7-21-14-16-36(17-15-21)20-22-8-2-1-3-9-22/h1-3,6,8-13,19,21,34-35H,4-5,7,14-18,20H2 |
| InChIKey | DRBCNMVFLCFWRG-UHFFFAOYSA-N |
| XLogP | 7.88 |
| TPSA | 74.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 604.58 |
| LogP ≤ 5 | 7.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|