C21H27FN2O2S — CID 74227028
N-[2-(1-benzylpiperidin-4-yl)ethyl]-5-fluoro-2-methylbenzenesulfonamide (PubChem CID 74227028) has the molecular formula C21H27FN2O2S and a molecular weight of 390.52 g/mol. Its IUPAC name is N-[2-(1-benzylpiperidin-4-yl)ethyl]-5-fluoro-2-methylbenzenesulfonamide.
| Compound Name | N-[2-(1-benzylpiperidin-4-yl)ethyl]-5-fluoro-2-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 74227028 |
| Molecular Formula | C21H27FN2O2S |
| Molecular Weight | 390.52 g/mol |
| Exact Mass | 390.18 |
| IUPAC Name | N-[2-(1-benzylpiperidin-4-yl)ethyl]-5-fluoro-2-methylbenzenesulfonamide |
| SMILES | Cc1ccc(F)cc1S(=O)(=O)NCCC1CCN(Cc2ccccc2)CC1 |
| InChI | InChI=1S/C21H27FN2O2S/c1-17-7-8-20(22)15-21(17)27(25,26)23-12-9-18-10-13-24(14-11-18)16-19-5-3-2-4-6-19/h2-8,15,18,23H,9-14,16H2,1H3 |
| InChIKey | DHARADNRYRXEHF-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.52 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |