C27H30Cl2FN3O5S — CID 164877442
tert-butyl (3aR,6aS)-5-[[4-[(3,4-dichloro-1H-indol-7-yl)sulfamoyl]-3-fluorophenoxy]methyl]-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrole-2-carboxylate (PubChem CID 164877442) has the molecular formula C27H30Cl2FN3O5S and a molecular weight of 598.52 g/mol. Its IUPAC name is tert-butyl (3aR,6aS)-5-[[4-[(3,4-dichloro-1H-indol-7-yl)sulfamoyl]-3-fluorophenoxy]methyl]-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrole-2-carboxylate.
| Compound Name | tert-butyl (3aR,6aS)-5-[[4-[(3,4-dichloro-1H-indol-7-yl)sulfamoyl]-3-fluorophenoxy]methyl]-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrole-2-carboxylate |
|---|---|
| PubChem CID | 164877442 |
| Molecular Formula | C27H30Cl2FN3O5S |
| Molecular Weight | 598.52 g/mol |
| Exact Mass | 597.13 |
| IUPAC Name | tert-butyl (3aR,6aS)-5-[[4-[(3,4-dichloro-1H-indol-7-yl)sulfamoyl]-3-fluorophenoxy]methyl]-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrole-2-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1C[C@H]2CC(COc3ccc(S(=O)(=O)Nc4ccc(Cl)c5c(Cl)c[nH]c45)c(F)c3)C[C@H]2C1 |
| InChI | InChI=1S/C27H30Cl2FN3O5S/c1-27(2,3)38-26(34)33-12-16-8-15(9-17(16)13-33)14-37-18-4-7-23(21(30)10-18)39(35,36)32-22-6-5-19(28)24-20(29)11-31-25(22)24/h4-7,10-11,15-17,31-32H,8-9,12-14H2,1-3H3/t15?,16-,17+ |
| InChIKey | AYHZIAHOVVLKOG-ALOPSCKCSA-N |
| XLogP | 6.69 |
| TPSA | 100.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 598.52 |
| LogP ≤ 5 | 6.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |