C18H24ClFN2O4 — CID 175746278
tert-butyl (3R)-3-[[2-(4-chloro-3-fluorophenoxy)acetyl]amino]piperidine-1-carboxylate (PubChem CID 175746278) has the molecular formula C18H24ClFN2O4 and a molecular weight of 386.85 g/mol. Its IUPAC name is tert-butyl (3R)-3-[[2-(4-chloro-3-fluorophenoxy)acetyl]amino]piperidine-1-carboxylate.
| Compound Name | tert-butyl (3R)-3-[[2-(4-chloro-3-fluorophenoxy)acetyl]amino]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 175746278 |
| Molecular Formula | C18H24ClFN2O4 |
| Molecular Weight | 386.85 g/mol |
| Exact Mass | 386.14 |
| IUPAC Name | tert-butyl (3R)-3-[[2-(4-chloro-3-fluorophenoxy)acetyl]amino]piperidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC[C@@H](NC(=O)COc2ccc(Cl)c(F)c2)C1 |
| InChI | InChI=1S/C18H24ClFN2O4/c1-18(2,3)26-17(24)22-8-4-5-12(10-22)21-16(23)11-25-13-6-7-14(19)15(20)9-13/h6-7,9,12H,4-5,8,10-11H2,1-3H3,(H,21,23)/t12-/m1/s1 |
| InChIKey | USCAVLJYGNRDQS-GFCCVEGCSA-N |
| XLogP | 3.37 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.85 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |