C19H24ClFN2O4 — CID 161470649
tert-butyl 3-[[3-(4-chloro-3-fluorophenyl)-2-oxopropanoyl]amino]piperidine-1-carboxylate (PubChem CID 161470649) has the molecular formula C19H24ClFN2O4 and a molecular weight of 398.86 g/mol. Its IUPAC name is tert-butyl 3-[[3-(4-chloro-3-fluorophenyl)-2-oxopropanoyl]amino]piperidine-1-carboxylate.
| Compound Name | tert-butyl 3-[[3-(4-chloro-3-fluorophenyl)-2-oxopropanoyl]amino]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 161470649 |
| Molecular Formula | C19H24ClFN2O4 |
| Molecular Weight | 398.86 g/mol |
| Exact Mass | 398.14 |
| IUPAC Name | tert-butyl 3-[[3-(4-chloro-3-fluorophenyl)-2-oxopropanoyl]amino]piperidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCCC(NC(=O)C(=O)Cc2ccc(Cl)c(F)c2)C1 |
| InChI | InChI=1S/C19H24ClFN2O4/c1-19(2,3)27-18(26)23-8-4-5-13(11-23)22-17(25)16(24)10-12-6-7-14(20)15(21)9-12/h6-7,9,13H,4-5,8,10-11H2,1-3H3,(H,22,25) |
| InChIKey | PWKVBWLPLZPZSM-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.86 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|