C22H28ClF4N3O7 — CID 175510815
tert-butyl (2S)-5-[[2-(4-chloro-3-fluorophenoxy)acetyl]amino]-2-[2-(trifluoromethoxy)ethoxycarbamoyl]piperidine-1-carboxylate (PubChem CID 175510815) has the molecular formula C22H28ClF4N3O7 and a molecular weight of 557.93 g/mol. Its IUPAC name is tert-butyl (2S)-5-[[2-(4-chloro-3-fluorophenoxy)acetyl]amino]-2-[2-(trifluoromethoxy)ethoxycarbamoyl]piperidine-1-carboxylate.
| Compound Name | tert-butyl (2S)-5-[[2-(4-chloro-3-fluorophenoxy)acetyl]amino]-2-[2-(trifluoromethoxy)ethoxycarbamoyl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 175510815 |
| Molecular Formula | C22H28ClF4N3O7 |
| Molecular Weight | 557.93 g/mol |
| Exact Mass | 557.16 |
| IUPAC Name | tert-butyl (2S)-5-[[2-(4-chloro-3-fluorophenoxy)acetyl]amino]-2-[2-(trifluoromethoxy)ethoxycarbamoyl]piperidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CC(NC(=O)COc2ccc(Cl)c(F)c2)CC[C@H]1C(=O)NOCCOC(F)(F)F |
| InChI | InChI=1S/C22H28ClF4N3O7/c1-21(2,3)37-20(33)30-11-13(28-18(31)12-34-14-5-6-15(23)16(24)10-14)4-7-17(30)19(32)29-36-9-8-35-22(25,26)27/h5-6,10,13,17H,4,7-9,11-12H2,1-3H3,(H,28,31)(H,29,32)/t13?,17-/m0/s1 |
| InChIKey | TWOJCCPHWZCMBZ-RUINGEJQSA-N |
| XLogP | 3.33 |
| TPSA | 115.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 557.93 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|