C18H22ClF4N3O4 — CID 175510803
5-[[2-(4-chloro-3-fluorophenoxy)acetyl]amino]-N-[3-(trifluoromethoxy)propyl]piperidine-2-carboxamide (PubChem CID 175510803) has the molecular formula C18H22ClF4N3O4 and a molecular weight of 455.84 g/mol. Its IUPAC name is 5-[[2-(4-chloro-3-fluorophenoxy)acetyl]amino]-N-[3-(trifluoromethoxy)propyl]piperidine-2-carboxamide.
| Compound Name | 5-[[2-(4-chloro-3-fluorophenoxy)acetyl]amino]-N-[3-(trifluoromethoxy)propyl]piperidine-2-carboxamide |
|---|---|
| PubChem CID | 175510803 |
| Molecular Formula | C18H22ClF4N3O4 |
| Molecular Weight | 455.84 g/mol |
| Exact Mass | 455.12 |
| IUPAC Name | 5-[[2-(4-chloro-3-fluorophenoxy)acetyl]amino]-N-[3-(trifluoromethoxy)propyl]piperidine-2-carboxamide |
| SMILES | O=C(COc1ccc(Cl)c(F)c1)NC1CCC(C(=O)NCCCOC(F)(F)F)NC1 |
| InChI | InChI=1S/C18H22ClF4N3O4/c19-13-4-3-12(8-14(13)20)29-10-16(27)26-11-2-5-15(25-9-11)17(28)24-6-1-7-30-18(21,22)23/h3-4,8,11,15,25H,1-2,5-7,9-10H2,(H,24,28)(H,26,27) |
| InChIKey | UQHFSSOFNDIXPG-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 88.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.84 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|