C19H22ClF4NO5 — CID 139517471
2-(4-chloro-3-fluorophenoxy)-N-[3-[2-[3-(trifluoromethoxy)cyclobutyl]oxyethoxy]cyclobutyl]acetamide (PubChem CID 139517471) has the molecular formula C19H22ClF4NO5 and a molecular weight of 455.83 g/mol. Its IUPAC name is 2-(4-chloro-3-fluorophenoxy)-N-[3-[2-[3-(trifluoromethoxy)cyclobutyl]oxyethoxy]cyclobutyl]acetamide.
| Compound Name | 2-(4-chloro-3-fluorophenoxy)-N-[3-[2-[3-(trifluoromethoxy)cyclobutyl]oxyethoxy]cyclobutyl]acetamide |
|---|---|
| PubChem CID | 139517471 |
| Molecular Formula | C19H22ClF4NO5 |
| Molecular Weight | 455.83 g/mol |
| Exact Mass | 455.11 |
| IUPAC Name | 2-(4-chloro-3-fluorophenoxy)-N-[3-[2-[3-(trifluoromethoxy)cyclobutyl]oxyethoxy]cyclobutyl]acetamide |
| SMILES | O=C(COc1ccc(Cl)c(F)c1)NC1CC(OCCOC2CC(OC(F)(F)F)C2)C1 |
| InChI | InChI=1S/C19H22ClF4NO5/c20-16-2-1-12(9-17(16)21)29-10-18(26)25-11-5-13(6-11)27-3-4-28-14-7-15(8-14)30-19(22,23)24/h1-2,9,11,13-15H,3-8,10H2,(H,25,26) |
| InChIKey | MTWRYTSKPXTOIJ-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 66.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.83 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|