C19H21ClF4N4O4 — CID 155234829
2-(4-chloro-3-fluorophenoxy)-N-[(3S,6R)-6-[5-(4,4,4-trifluorobutoxy)-1,3,4-oxadiazol-2-yl]piperidin-3-yl]acetamide (PubChem CID 155234829) has the molecular formula C19H21ClF4N4O4 and a molecular weight of 480.85 g/mol. Its IUPAC name is 2-(4-chloro-3-fluorophenoxy)-N-[(3S,6R)-6-[5-(4,4,4-trifluorobutoxy)-1,3,4-oxadiazol-2-yl]piperidin-3-yl]acetamide.
| Compound Name | 2-(4-chloro-3-fluorophenoxy)-N-[(3S,6R)-6-[5-(4,4,4-trifluorobutoxy)-1,3,4-oxadiazol-2-yl]piperidin-3-yl]acetamide |
|---|---|
| PubChem CID | 155234829 |
| Molecular Formula | C19H21ClF4N4O4 |
| Molecular Weight | 480.85 g/mol |
| Exact Mass | 480.12 |
| IUPAC Name | 2-(4-chloro-3-fluorophenoxy)-N-[(3S,6R)-6-[5-(4,4,4-trifluorobutoxy)-1,3,4-oxadiazol-2-yl]piperidin-3-yl]acetamide |
| SMILES | O=C(COc1ccc(Cl)c(F)c1)N[C@H]1CC[C@H](c2nnc(OCCCC(F)(F)F)o2)NC1 |
| InChI | InChI=1S/C19H21ClF4N4O4/c20-13-4-3-12(8-14(13)21)31-10-16(29)26-11-2-5-15(25-9-11)17-27-28-18(32-17)30-7-1-6-19(22,23)24/h3-4,8,11,15,25H,1-2,5-7,9-10H2,(H,26,29)/t11-,15+/m0/s1 |
| InChIKey | GGBVEQCAGKSLEP-XHDPSFHLSA-N |
| XLogP | 3.57 |
| TPSA | 98.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.85 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|