C21H26ClFN4O5 — CID 162689786
2-(4-chloro-3-fluorophenoxy)-N-[(3S,6R)-6-[5-(2-cyclobutyloxyethoxy)-1,3,4-oxadiazol-2-yl]piperidin-3-yl]acetamide (PubChem CID 162689786) has the molecular formula C21H26ClFN4O5 and a molecular weight of 468.91 g/mol. Its IUPAC name is 2-(4-chloro-3-fluorophenoxy)-N-[(3S,6R)-6-[5-(2-cyclobutyloxyethoxy)-1,3,4-oxadiazol-2-yl]piperidin-3-yl]acetamide.
| Compound Name | 2-(4-chloro-3-fluorophenoxy)-N-[(3S,6R)-6-[5-(2-cyclobutyloxyethoxy)-1,3,4-oxadiazol-2-yl]piperidin-3-yl]acetamide |
|---|---|
| PubChem CID | 162689786 |
| Molecular Formula | C21H26ClFN4O5 |
| Molecular Weight | 468.91 g/mol |
| Exact Mass | 468.16 |
| IUPAC Name | 2-(4-chloro-3-fluorophenoxy)-N-[(3S,6R)-6-[5-(2-cyclobutyloxyethoxy)-1,3,4-oxadiazol-2-yl]piperidin-3-yl]acetamide |
| SMILES | O=C(COc1ccc(Cl)c(F)c1)N[C@H]1CC[C@H](c2nnc(OCCOC3CCC3)o2)NC1 |
| InChI | InChI=1S/C21H26ClFN4O5/c22-16-6-5-15(10-17(16)23)31-12-19(28)25-13-4-7-18(24-11-13)20-26-27-21(32-20)30-9-8-29-14-2-1-3-14/h5-6,10,13-14,18,24H,1-4,7-9,11-12H2,(H,25,28)/t13-,18+/m0/s1 |
| InChIKey | TWQKTRGPWRFCNJ-SCLBCKFNSA-N |
| XLogP | 2.80 |
| TPSA | 107.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.91 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|