C17H18ClF3N4O4 — CID 163263691
4-chloro-N-[(3S,6R)-6-[5-[2-(trifluoromethoxy)ethoxy]-1,3,4-oxadiazol-2-yl]piperidin-3-yl]benzamide (PubChem CID 163263691) has the molecular formula C17H18ClF3N4O4 and a molecular weight of 434.80 g/mol. Its IUPAC name is 4-chloro-N-[(3S,6R)-6-[5-[2-(trifluoromethoxy)ethoxy]-1,3,4-oxadiazol-2-yl]piperidin-3-yl]benzamide.
| Compound Name | 4-chloro-N-[(3S,6R)-6-[5-[2-(trifluoromethoxy)ethoxy]-1,3,4-oxadiazol-2-yl]piperidin-3-yl]benzamide |
|---|---|
| PubChem CID | 163263691 |
| Molecular Formula | C17H18ClF3N4O4 |
| Molecular Weight | 434.80 g/mol |
| Exact Mass | 434.10 |
| IUPAC Name | 4-chloro-N-[(3S,6R)-6-[5-[2-(trifluoromethoxy)ethoxy]-1,3,4-oxadiazol-2-yl]piperidin-3-yl]benzamide |
| SMILES | O=C(N[C@H]1CC[C@H](c2nnc(OCCOC(F)(F)F)o2)NC1)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C17H18ClF3N4O4/c18-11-3-1-10(2-4-11)14(26)23-12-5-6-13(22-9-12)15-24-25-16(29-15)27-7-8-28-17(19,20)21/h1-4,12-13,22H,5-9H2,(H,23,26)/t12-,13+/m0/s1 |
| InChIKey | FMLHMUNHSWUAQE-QWHCGFSZSA-N |
| XLogP | 2.86 |
| TPSA | 98.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.80 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|