C20H20ClF3N4O5 — CID 169101514
7-chloro-N-[(3S,6R)-6-[5-[2-(trifluoromethoxy)ethoxy]-1,3,4-oxadiazol-2-yl]piperidin-3-yl]-2H-chromene-3-carboxamide (PubChem CID 169101514) has the molecular formula C20H20ClF3N4O5 and a molecular weight of 488.85 g/mol. Its IUPAC name is 7-chloro-N-[(3S,6R)-6-[5-[2-(trifluoromethoxy)ethoxy]-1,3,4-oxadiazol-2-yl]piperidin-3-yl]-2H-chromene-3-carboxamide.
| Compound Name | 7-chloro-N-[(3S,6R)-6-[5-[2-(trifluoromethoxy)ethoxy]-1,3,4-oxadiazol-2-yl]piperidin-3-yl]-2H-chromene-3-carboxamide |
|---|---|
| PubChem CID | 169101514 |
| Molecular Formula | C20H20ClF3N4O5 |
| Molecular Weight | 488.85 g/mol |
| Exact Mass | 488.11 |
| IUPAC Name | 7-chloro-N-[(3S,6R)-6-[5-[2-(trifluoromethoxy)ethoxy]-1,3,4-oxadiazol-2-yl]piperidin-3-yl]-2H-chromene-3-carboxamide |
| SMILES | O=C(N[C@H]1CC[C@H](c2nnc(OCCOC(F)(F)F)o2)NC1)C1=Cc2ccc(Cl)cc2OC1 |
| InChI | InChI=1S/C20H20ClF3N4O5/c21-13-2-1-11-7-12(10-31-16(11)8-13)17(29)26-14-3-4-15(25-9-14)18-27-28-19(33-18)30-5-6-32-20(22,23)24/h1-2,7-8,14-15,25H,3-6,9-10H2,(H,26,29)/t14-,15+/m0/s1 |
| InChIKey | OURXQIJXYSUWAW-LSDHHAIUSA-N |
| XLogP | 3.02 |
| TPSA | 107.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.85 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|