C19H19ClF3N5O4 — CID 169101498
7-chloro-N-[(3S,6R)-6-[5-[2-(trifluoromethoxy)ethoxy]-1,3,4-oxadiazol-2-yl]piperidin-3-yl]indolizine-2-carboxamide (PubChem CID 169101498) has the molecular formula C19H19ClF3N5O4 and a molecular weight of 473.84 g/mol. Its IUPAC name is 7-chloro-N-[(3S,6R)-6-[5-[2-(trifluoromethoxy)ethoxy]-1,3,4-oxadiazol-2-yl]piperidin-3-yl]indolizine-2-carboxamide.
| Compound Name | 7-chloro-N-[(3S,6R)-6-[5-[2-(trifluoromethoxy)ethoxy]-1,3,4-oxadiazol-2-yl]piperidin-3-yl]indolizine-2-carboxamide |
|---|---|
| PubChem CID | 169101498 |
| Molecular Formula | C19H19ClF3N5O4 |
| Molecular Weight | 473.84 g/mol |
| Exact Mass | 473.11 |
| IUPAC Name | 7-chloro-N-[(3S,6R)-6-[5-[2-(trifluoromethoxy)ethoxy]-1,3,4-oxadiazol-2-yl]piperidin-3-yl]indolizine-2-carboxamide |
| SMILES | O=C(N[C@H]1CC[C@H](c2nnc(OCCOC(F)(F)F)o2)NC1)c1cc2cc(Cl)ccn2c1 |
| InChI | InChI=1S/C19H19ClF3N5O4/c20-12-3-4-28-10-11(7-14(28)8-12)16(29)25-13-1-2-15(24-9-13)17-26-27-18(32-17)30-5-6-31-19(21,22)23/h3-4,7-8,10,13,15,24H,1-2,5-6,9H2,(H,25,29)/t13-,15+/m0/s1 |
| InChIKey | ABTYYIYZSONSRE-DZGCQCFKSA-N |
| XLogP | 3.11 |
| TPSA | 102.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.84 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|