C22H28Cl2FN3O3 — CID 138626804
5-chloro-N-[(4S)-4-[[2-(4-chloro-3-fluorophenoxy)acetyl]amino]-2-bicyclo[3.2.0]heptanyl]-4-methylpiperidine-2-carboxamide (PubChem CID 138626804) has the molecular formula C22H28Cl2FN3O3 and a molecular weight of 472.39 g/mol. Its IUPAC name is 5-chloro-N-[(4S)-4-[[2-(4-chloro-3-fluorophenoxy)acetyl]amino]-2-bicyclo[3.2.0]heptanyl]-4-methylpiperidine-2-carboxamide.
| Compound Name | 5-chloro-N-[(4S)-4-[[2-(4-chloro-3-fluorophenoxy)acetyl]amino]-2-bicyclo[3.2.0]heptanyl]-4-methylpiperidine-2-carboxamide |
|---|---|
| PubChem CID | 138626804 |
| Molecular Formula | C22H28Cl2FN3O3 |
| Molecular Weight | 472.39 g/mol |
| Exact Mass | 471.15 |
| IUPAC Name | 5-chloro-N-[(4S)-4-[[2-(4-chloro-3-fluorophenoxy)acetyl]amino]-2-bicyclo[3.2.0]heptanyl]-4-methylpiperidine-2-carboxamide |
| SMILES | CC1CC(C(=O)NC2C[C@H](NC(=O)COc3ccc(Cl)c(F)c3)C3CCC23)NCC1Cl |
| InChI | InChI=1S/C22H28Cl2FN3O3/c1-11-6-20(26-9-16(11)24)22(30)28-19-8-18(13-3-4-14(13)19)27-21(29)10-31-12-2-5-15(23)17(25)7-12/h2,5,7,11,13-14,16,18-20,26H,3-4,6,8-10H2,1H3,(H,27,29)(H,28,30)/t11?,13?,14?,16?,18-,19?,20?/m0/s1 |
| InChIKey | LVVKLYNVNGNFNZ-CUTKARRSSA-N |
| XLogP | 2.86 |
| TPSA | 79.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.39 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|