C22H27ClFN3O4S — CID 138626922
2-acetamido-N-[(4S)-4-[[2-(4-chloro-3-fluorophenoxy)acetyl]amino]-2-bicyclo[3.2.0]heptanyl]thiolane-3-carboxamide (PubChem CID 138626922) has the molecular formula C22H27ClFN3O4S and a molecular weight of 483.99 g/mol. Its IUPAC name is 2-acetamido-N-[(4S)-4-[[2-(4-chloro-3-fluorophenoxy)acetyl]amino]-2-bicyclo[3.2.0]heptanyl]thiolane-3-carboxamide.
| Compound Name | 2-acetamido-N-[(4S)-4-[[2-(4-chloro-3-fluorophenoxy)acetyl]amino]-2-bicyclo[3.2.0]heptanyl]thiolane-3-carboxamide |
|---|---|
| PubChem CID | 138626922 |
| Molecular Formula | C22H27ClFN3O4S |
| Molecular Weight | 483.99 g/mol |
| Exact Mass | 483.14 |
| IUPAC Name | 2-acetamido-N-[(4S)-4-[[2-(4-chloro-3-fluorophenoxy)acetyl]amino]-2-bicyclo[3.2.0]heptanyl]thiolane-3-carboxamide |
| SMILES | CC(=O)NC1SCCC1C(=O)NC1C[C@H](NC(=O)COc2ccc(Cl)c(F)c2)C2CCC12 |
| InChI | InChI=1S/C22H27ClFN3O4S/c1-11(28)25-22-15(6-7-32-22)21(30)27-19-9-18(13-3-4-14(13)19)26-20(29)10-31-12-2-5-16(23)17(24)8-12/h2,5,8,13-15,18-19,22H,3-4,6-7,9-10H2,1H3,(H,25,28)(H,26,29)(H,27,30)/t13?,14?,15?,18-,19?,22?/m0/s1 |
| InChIKey | AIZXZQUGOHOLGJ-WLOCUNRVSA-N |
| XLogP | 2.47 |
| TPSA | 96.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.99 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |