C18H22ClF4N3O4 — CID 163263548
N-[1-[[2-(4-chloro-3-fluorophenoxy)acetyl]amino]-3-(trifluoromethoxy)propyl]piperidine-2-carboxamide (PubChem CID 163263548) has the molecular formula C18H22ClF4N3O4 and a molecular weight of 455.84 g/mol. Its IUPAC name is N-[1-[[2-(4-chloro-3-fluorophenoxy)acetyl]amino]-3-(trifluoromethoxy)propyl]piperidine-2-carboxamide.
| Compound Name | N-[1-[[2-(4-chloro-3-fluorophenoxy)acetyl]amino]-3-(trifluoromethoxy)propyl]piperidine-2-carboxamide |
|---|---|
| PubChem CID | 163263548 |
| Molecular Formula | C18H22ClF4N3O4 |
| Molecular Weight | 455.84 g/mol |
| Exact Mass | 455.12 |
| IUPAC Name | N-[1-[[2-(4-chloro-3-fluorophenoxy)acetyl]amino]-3-(trifluoromethoxy)propyl]piperidine-2-carboxamide |
| SMILES | O=C(COc1ccc(Cl)c(F)c1)NC(CCOC(F)(F)F)NC(=O)C1CCCCN1 |
| InChI | InChI=1S/C18H22ClF4N3O4/c19-12-5-4-11(9-13(12)20)29-10-16(27)25-15(6-8-30-18(21,22)23)26-17(28)14-3-1-2-7-24-14/h4-5,9,14-15,24H,1-3,6-8,10H2,(H,25,27)(H,26,28) |
| InChIKey | FRQLQKGTGUETLY-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 88.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.84 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|