C20H18ClF5N3O3Si — CID 163263592
CID 163263592 (PubChem CID 163263592) has the molecular formula C20H18ClF5N3O3Si and a molecular weight of 506.91 g/mol.
| Compound Name | CID 163263592 |
|---|---|
| PubChem CID | 163263592 |
| Molecular Formula | C20H18ClF5N3O3Si |
| Molecular Weight | 506.91 g/mol |
| Exact Mass | 506.07 |
| IUPAC Name | — |
| SMILES | O=C(COc1ccc(Cl)c(F)c1)N[Si]1CC[C@H](C(=O)Nc2ccc(F)c(C(F)(F)F)c2)NC1 |
| InChI | InChI=1S/C20H18ClF5N3O3Si/c21-14-3-2-12(8-16(14)23)32-9-18(30)29-33-6-5-17(27-10-33)19(31)28-11-1-4-15(22)13(7-11)20(24,25)26/h1-4,7-8,17,27H,5-6,9-10H2,(H,28,31)(H,29,30)/t17-/m1/s1 |
| InChIKey | XIFJQELZTBBSSQ-QGZVFWFLSA-N |
| XLogP | 3.66 |
| TPSA | 79.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.91 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|