C17H23ClFN2O3Si — CID 155714325
CID 155714325 (PubChem CID 155714325) has the molecular formula C17H23ClFN2O3Si and a molecular weight of 385.92 g/mol.
| Compound Name | CID 155714325 |
|---|---|
| PubChem CID | 155714325 |
| Molecular Formula | C17H23ClFN2O3Si |
| Molecular Weight | 385.92 g/mol |
| Exact Mass | 385.12 |
| IUPAC Name | — |
| SMILES | C=C(OCC)[C@H]1CC[Si](NC(=O)COc2ccc(Cl)c(F)c2)CN1C |
| InChI | InChI=1S/C17H23ClFN2O3Si/c1-4-23-12(2)16-7-8-25(11-21(16)3)20-17(22)10-24-13-5-6-14(18)15(19)9-13/h5-6,9,16H,2,4,7-8,10-11H2,1,3H3,(H,20,22)/t16-/m1/s1 |
| InChIKey | GOXODEIRIBPXAU-MRXNPFEDSA-N |
| XLogP | 2.76 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.92 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|