C18H20ClF4N4O5Si — CID 155714396
CID 155714396 (PubChem CID 155714396) has the molecular formula C18H20ClF4N4O5Si and a molecular weight of 511.91 g/mol.
| Compound Name | CID 155714396 |
|---|---|
| PubChem CID | 155714396 |
| Molecular Formula | C18H20ClF4N4O5Si |
| Molecular Weight | 511.91 g/mol |
| Exact Mass | 511.08 |
| IUPAC Name | — |
| SMILES | CN1C[Si](NC(=O)COc2ccc(Cl)c(F)c2)CC[C@@H]1c1nnc(OCCOC(F)(F)F)o1 |
| InChI | InChI=1S/C18H20ClF4N4O5Si/c1-27-10-33(26-15(28)9-30-11-2-3-12(19)13(20)8-11)7-4-14(27)16-24-25-17(32-16)29-5-6-31-18(21,22)23/h2-3,8,14H,4-7,9-10H2,1H3,(H,26,28)/t14-/m1/s1 |
| InChIKey | GXOUNVJYVXSJND-CQSZACIVSA-N |
| XLogP | 2.88 |
| TPSA | 98.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.91 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|