C20H16Cl2FN4O4Si — CID 155714376
CID 155714376 (PubChem CID 155714376) has the molecular formula C20H16Cl2FN4O4Si and a molecular weight of 494.36 g/mol.
| Compound Name | CID 155714376 |
|---|---|
| PubChem CID | 155714376 |
| Molecular Formula | C20H16Cl2FN4O4Si |
| Molecular Weight | 494.36 g/mol |
| Exact Mass | 493.03 |
| IUPAC Name | — |
| SMILES | O=C(COc1ccc(Cl)c(F)c1)N[Si]1CC[C@H](c2nnc(-c3ccc(Cl)cc3)o2)NC1=O |
| InChI | InChI=1S/C20H16Cl2FN4O4Si/c21-12-3-1-11(2-4-12)18-25-26-19(31-18)16-7-8-32(20(29)24-16)27-17(28)10-30-13-5-6-14(22)15(23)9-13/h1-6,9,16H,7-8,10H2,(H,24,29)(H,27,28)/t16-/m1/s1 |
| InChIKey | ZFZOYULVXRQYJH-MRXNPFEDSA-N |
| XLogP | 4.11 |
| TPSA | 106.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.36 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|