C21H22F4N2O4S — CID 28551952
2-[4-(cyclohexylsulfamoyl)phenoxy]-N-[4-fluoro-3-(trifluoromethyl)phenyl]acetamide (PubChem CID 28551952) has the molecular formula C21H22F4N2O4S and a molecular weight of 474.48 g/mol. Its IUPAC name is 2-[4-(cyclohexylsulfamoyl)phenoxy]-N-[4-fluoro-3-(trifluoromethyl)phenyl]acetamide.
| Compound Name | 2-[4-(cyclohexylsulfamoyl)phenoxy]-N-[4-fluoro-3-(trifluoromethyl)phenyl]acetamide |
|---|---|
| PubChem CID | 28551952 |
| Molecular Formula | C21H22F4N2O4S |
| Molecular Weight | 474.48 g/mol |
| Exact Mass | 474.12 |
| IUPAC Name | 2-[4-(cyclohexylsulfamoyl)phenoxy]-N-[4-fluoro-3-(trifluoromethyl)phenyl]acetamide |
| SMILES | O=C(COc1ccc(S(=O)(=O)NC2CCCCC2)cc1)Nc1ccc(F)c(C(F)(F)F)c1 |
| InChI | InChI=1S/C21H22F4N2O4S/c22-19-11-6-15(12-18(19)21(23,24)25)26-20(28)13-31-16-7-9-17(10-8-16)32(29,30)27-14-4-2-1-3-5-14/h6-12,14,27H,1-5,13H2,(H,26,28) |
| InChIKey | SBVRWXODRIKZMR-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.48 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |