C20H20ClF3N2O4S — CID 45372513
N-[4-chloro-2-(trifluoromethyl)phenyl]-2-[4-(cyclopentylsulfamoyl)phenoxy]acetamide (PubChem CID 45372513) has the molecular formula C20H20ClF3N2O4S and a molecular weight of 476.90 g/mol. Its IUPAC name is N-[4-chloro-2-(trifluoromethyl)phenyl]-2-[4-(cyclopentylsulfamoyl)phenoxy]acetamide.
| Compound Name | N-[4-chloro-2-(trifluoromethyl)phenyl]-2-[4-(cyclopentylsulfamoyl)phenoxy]acetamide |
|---|---|
| PubChem CID | 45372513 |
| Molecular Formula | C20H20ClF3N2O4S |
| Molecular Weight | 476.90 g/mol |
| Exact Mass | 476.08 |
| IUPAC Name | N-[4-chloro-2-(trifluoromethyl)phenyl]-2-[4-(cyclopentylsulfamoyl)phenoxy]acetamide |
| SMILES | O=C(COc1ccc(S(=O)(=O)NC2CCCC2)cc1)Nc1ccc(Cl)cc1C(F)(F)F |
| InChI | InChI=1S/C20H20ClF3N2O4S/c21-13-5-10-18(17(11-13)20(22,23)24)25-19(27)12-30-15-6-8-16(9-7-15)31(28,29)26-14-3-1-2-4-14/h5-11,14,26H,1-4,12H2,(H,25,27) |
| InChIKey | GEWZWSMEHPTUIR-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.90 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |