C21H22ClF3N2O4S — CID 1008131
2-[2-chloro-4-(cyclohexylsulfamoyl)phenoxy]-N-[2-(trifluoromethyl)phenyl]acetamide (PubChem CID 1008131) has the molecular formula C21H22ClF3N2O4S and a molecular weight of 490.93 g/mol. Its IUPAC name is 2-[2-chloro-4-(cyclohexylsulfamoyl)phenoxy]-N-[2-(trifluoromethyl)phenyl]acetamide.
| Compound Name | 2-[2-chloro-4-(cyclohexylsulfamoyl)phenoxy]-N-[2-(trifluoromethyl)phenyl]acetamide |
|---|---|
| PubChem CID | 1008131 |
| Molecular Formula | C21H22ClF3N2O4S |
| Molecular Weight | 490.93 g/mol |
| Exact Mass | 490.09 |
| IUPAC Name | 2-[2-chloro-4-(cyclohexylsulfamoyl)phenoxy]-N-[2-(trifluoromethyl)phenyl]acetamide |
| SMILES | O=C(COc1ccc(S(=O)(=O)NC2CCCCC2)cc1Cl)Nc1ccccc1C(F)(F)F |
| InChI | InChI=1S/C21H22ClF3N2O4S/c22-17-12-15(32(29,30)27-14-6-2-1-3-7-14)10-11-19(17)31-13-20(28)26-18-9-5-4-8-16(18)21(23,24)25/h4-5,8-12,14,27H,1-3,6-7,13H2,(H,26,28) |
| InChIKey | RBDPZORXMRGKCC-UHFFFAOYSA-N |
| XLogP | 4.99 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.93 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |