C22H27ClN2O5S — CID 28556105
2-[2-chloro-4-(cyclopentylsulfamoyl)phenoxy]-N-[(1R)-1-(2-methoxyphenyl)ethyl]acetamide (PubChem CID 28556105) has the molecular formula C22H27ClN2O5S and a molecular weight of 466.99 g/mol. Its IUPAC name is 2-[2-chloro-4-(cyclopentylsulfamoyl)phenoxy]-N-[(1R)-1-(2-methoxyphenyl)ethyl]acetamide.
| Compound Name | 2-[2-chloro-4-(cyclopentylsulfamoyl)phenoxy]-N-[(1R)-1-(2-methoxyphenyl)ethyl]acetamide |
|---|---|
| PubChem CID | 28556105 |
| Molecular Formula | C22H27ClN2O5S |
| Molecular Weight | 466.99 g/mol |
| Exact Mass | 466.13 |
| IUPAC Name | 2-[2-chloro-4-(cyclopentylsulfamoyl)phenoxy]-N-[(1R)-1-(2-methoxyphenyl)ethyl]acetamide |
| SMILES | COc1ccccc1[C@@H](C)NC(=O)COc1ccc(S(=O)(=O)NC2CCCC2)cc1Cl |
| InChI | InChI=1S/C22H27ClN2O5S/c1-15(18-9-5-6-10-20(18)29-2)24-22(26)14-30-21-12-11-17(13-19(21)23)31(27,28)25-16-7-3-4-8-16/h5-6,9-13,15-16,25H,3-4,7-8,14H2,1-2H3,(H,24,26)/t15-/m1/s1 |
| InChIKey | JPENJVVDBIIJMN-OAHLLOKOSA-N |
| XLogP | 3.83 |
| TPSA | 93.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.99 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |