C24H32N2O4S — CID 43873814
3-[4-(cyclohexylsulfamoyl)phenyl]-N-[1-(2-methoxyphenyl)ethyl]propanamide (PubChem CID 43873814) has the molecular formula C24H32N2O4S and a molecular weight of 444.60 g/mol. Its IUPAC name is 3-[4-(cyclohexylsulfamoyl)phenyl]-N-[1-(2-methoxyphenyl)ethyl]propanamide.
| Compound Name | 3-[4-(cyclohexylsulfamoyl)phenyl]-N-[1-(2-methoxyphenyl)ethyl]propanamide |
|---|---|
| PubChem CID | 43873814 |
| Molecular Formula | C24H32N2O4S |
| Molecular Weight | 444.60 g/mol |
| Exact Mass | 444.21 |
| IUPAC Name | 3-[4-(cyclohexylsulfamoyl)phenyl]-N-[1-(2-methoxyphenyl)ethyl]propanamide |
| SMILES | COc1ccccc1C(C)NC(=O)CCc1ccc(S(=O)(=O)NC2CCCCC2)cc1 |
| InChI | InChI=1S/C24H32N2O4S/c1-18(22-10-6-7-11-23(22)30-2)25-24(27)17-14-19-12-15-21(16-13-19)31(28,29)26-20-8-4-3-5-9-20/h6-7,10-13,15-16,18,20,26H,3-5,8-9,14,17H2,1-2H3,(H,25,27) |
| InChIKey | VEJNEUWACWGZIZ-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.60 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |