C14H17ClNO5S- — CID 6957749
2-[2-chloro-4-(cyclohexylsulfamoyl)phenoxy]acetate (PubChem CID 6957749) has the molecular formula C14H17ClNO5S- and a molecular weight of 346.81 g/mol. Its IUPAC name is 2-[2-chloro-4-(cyclohexylsulfamoyl)phenoxy]acetate.
| Compound Name | 2-[2-chloro-4-(cyclohexylsulfamoyl)phenoxy]acetate |
|---|---|
| PubChem CID | 6957749 |
| Molecular Formula | C14H17ClNO5S- |
| Molecular Weight | 346.81 g/mol |
| Exact Mass | 346.05 |
| IUPAC Name | 2-[2-chloro-4-(cyclohexylsulfamoyl)phenoxy]acetate |
| SMILES | O=C([O-])COc1ccc(S(=O)(=O)NC2CCCCC2)cc1Cl |
| InChI | InChI=1S/C14H18ClNO5S/c15-12-8-11(6-7-13(12)21-9-14(17)18)22(19,20)16-10-4-2-1-3-5-10/h6-8,10,16H,1-5,9H2,(H,17,18)/p-1 |
| InChIKey | MPBJELXDJRFRGU-UHFFFAOYSA-M |
| XLogP | 1.08 |
| TPSA | 95.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.81 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |