C18H25ClN2O5S — CID 1093381
3-chloro-N-cyclohexyl-4-(2-morpholin-4-yl-2-oxoethoxy)benzenesulfonamide (PubChem CID 1093381) has the molecular formula C18H25ClN2O5S and a molecular weight of 416.93 g/mol. Its IUPAC name is 3-chloro-N-cyclohexyl-4-(2-morpholin-4-yl-2-oxoethoxy)benzenesulfonamide.
| Compound Name | 3-chloro-N-cyclohexyl-4-(2-morpholin-4-yl-2-oxoethoxy)benzenesulfonamide |
|---|---|
| PubChem CID | 1093381 |
| Molecular Formula | C18H25ClN2O5S |
| Molecular Weight | 416.93 g/mol |
| Exact Mass | 416.12 |
| IUPAC Name | 3-chloro-N-cyclohexyl-4-(2-morpholin-4-yl-2-oxoethoxy)benzenesulfonamide |
| SMILES | O=C(COc1ccc(S(=O)(=O)NC2CCCCC2)cc1Cl)N1CCOCC1 |
| InChI | InChI=1S/C18H25ClN2O5S/c19-16-12-15(27(23,24)20-14-4-2-1-3-5-14)6-7-17(16)26-13-18(22)21-8-10-25-11-9-21/h6-7,12,14,20H,1-5,8-11,13H2 |
| InChIKey | MDPDNGLOBFMBNL-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.93 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |