C20H22ClFN2O4S — CID 1264165
2-[2-chloro-4-(cyclohexylsulfamoyl)phenoxy]-N-(3-fluorophenyl)acetamide (PubChem CID 1264165) has the molecular formula C20H22ClFN2O4S and a molecular weight of 440.92 g/mol. Its IUPAC name is 2-[2-chloro-4-(cyclohexylsulfamoyl)phenoxy]-N-(3-fluorophenyl)acetamide.
| Compound Name | 2-[2-chloro-4-(cyclohexylsulfamoyl)phenoxy]-N-(3-fluorophenyl)acetamide |
|---|---|
| PubChem CID | 1264165 |
| Molecular Formula | C20H22ClFN2O4S |
| Molecular Weight | 440.92 g/mol |
| Exact Mass | 440.10 |
| IUPAC Name | 2-[2-chloro-4-(cyclohexylsulfamoyl)phenoxy]-N-(3-fluorophenyl)acetamide |
| SMILES | O=C(COc1ccc(S(=O)(=O)NC2CCCCC2)cc1Cl)Nc1cccc(F)c1 |
| InChI | InChI=1S/C20H22ClFN2O4S/c21-18-12-17(29(26,27)24-15-6-2-1-3-7-15)9-10-19(18)28-13-20(25)23-16-8-4-5-14(22)11-16/h4-5,8-12,15,24H,1-3,6-7,13H2,(H,23,25) |
| InChIKey | SFZSRZOWEGECLI-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.92 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |