C21H25ClN2O4S2 — CID 1008134
2-[2-chloro-4-(cyclohexylsulfamoyl)phenoxy]-N-(2-methylsulfanylphenyl)acetamide (PubChem CID 1008134) has the molecular formula C21H25ClN2O4S2 and a molecular weight of 469.03 g/mol. Its IUPAC name is 2-[2-chloro-4-(cyclohexylsulfamoyl)phenoxy]-N-(2-methylsulfanylphenyl)acetamide.
| Compound Name | 2-[2-chloro-4-(cyclohexylsulfamoyl)phenoxy]-N-(2-methylsulfanylphenyl)acetamide |
|---|---|
| PubChem CID | 1008134 |
| Molecular Formula | C21H25ClN2O4S2 |
| Molecular Weight | 469.03 g/mol |
| Exact Mass | 468.09 |
| IUPAC Name | 2-[2-chloro-4-(cyclohexylsulfamoyl)phenoxy]-N-(2-methylsulfanylphenyl)acetamide |
| SMILES | CSc1ccccc1NC(=O)COc1ccc(S(=O)(=O)NC2CCCCC2)cc1Cl |
| InChI | InChI=1S/C21H25ClN2O4S2/c1-29-20-10-6-5-9-18(20)23-21(25)14-28-19-12-11-16(13-17(19)22)30(26,27)24-15-7-3-2-4-8-15/h5-6,9-13,15,24H,2-4,7-8,14H2,1H3,(H,23,25) |
| InChIKey | PBNGVWMUVJLJFG-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.03 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |