C24H25ClN2O4S2 — CID 126274408
2-[2-chloro-4-(2-methylpropylsulfamoyl)phenoxy]-N-(2-phenylsulfanylphenyl)acetamide (PubChem CID 126274408) has the molecular formula C24H25ClN2O4S2 and a molecular weight of 505.06 g/mol. Its IUPAC name is 2-[2-chloro-4-(2-methylpropylsulfamoyl)phenoxy]-N-(2-phenylsulfanylphenyl)acetamide.
| Compound Name | 2-[2-chloro-4-(2-methylpropylsulfamoyl)phenoxy]-N-(2-phenylsulfanylphenyl)acetamide |
|---|---|
| PubChem CID | 126274408 |
| Molecular Formula | C24H25ClN2O4S2 |
| Molecular Weight | 505.06 g/mol |
| Exact Mass | 504.09 |
| IUPAC Name | 2-[2-chloro-4-(2-methylpropylsulfamoyl)phenoxy]-N-(2-phenylsulfanylphenyl)acetamide |
| SMILES | CC(C)CNS(=O)(=O)c1ccc(OCC(=O)Nc2ccccc2Sc2ccccc2)c(Cl)c1 |
| InChI | InChI=1S/C24H25ClN2O4S2/c1-17(2)15-26-33(29,30)19-12-13-22(20(25)14-19)31-16-24(28)27-21-10-6-7-11-23(21)32-18-8-4-3-5-9-18/h3-14,17,26H,15-16H2,1-2H3,(H,27,28) |
| InChIKey | YFRIFRXONYHEGF-UHFFFAOYSA-N |
| XLogP | 5.44 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.06 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |