C18H26N2O4S — CID 3634459
2-[4-(cyclohexylsulfamoyl)-2-methylphenoxy]-N-cyclopropylacetamide (PubChem CID 3634459) has the molecular formula C18H26N2O4S and a molecular weight of 366.48 g/mol. Its IUPAC name is 2-[4-(cyclohexylsulfamoyl)-2-methylphenoxy]-N-cyclopropylacetamide.
| Compound Name | 2-[4-(cyclohexylsulfamoyl)-2-methylphenoxy]-N-cyclopropylacetamide |
|---|---|
| PubChem CID | 3634459 |
| Molecular Formula | C18H26N2O4S |
| Molecular Weight | 366.48 g/mol |
| Exact Mass | 366.16 |
| IUPAC Name | 2-[4-(cyclohexylsulfamoyl)-2-methylphenoxy]-N-cyclopropylacetamide |
| SMILES | Cc1cc(S(=O)(=O)NC2CCCCC2)ccc1OCC(=O)NC1CC1 |
| InChI | InChI=1S/C18H26N2O4S/c1-13-11-16(25(22,23)20-15-5-3-2-4-6-15)9-10-17(13)24-12-18(21)19-14-7-8-14/h9-11,14-15,20H,2-8,12H2,1H3,(H,19,21) |
| InChIKey | ODOSJJAITFZOCU-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.48 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |