C16H12Cl2FN3OS — CID 164877481
3-[(3,4-dichloro-1H-indol-7-yl)amino]sulfanyl-2-fluoro-N-methylbenzamide (PubChem CID 164877481) has the molecular formula C16H12Cl2FN3OS and a molecular weight of 384.26 g/mol. Its IUPAC name is 3-[(3,4-dichloro-1H-indol-7-yl)amino]sulfanyl-2-fluoro-N-methylbenzamide.
| Compound Name | 3-[(3,4-dichloro-1H-indol-7-yl)amino]sulfanyl-2-fluoro-N-methylbenzamide |
|---|---|
| PubChem CID | 164877481 |
| Molecular Formula | C16H12Cl2FN3OS |
| Molecular Weight | 384.26 g/mol |
| Exact Mass | 383.01 |
| IUPAC Name | 3-[(3,4-dichloro-1H-indol-7-yl)amino]sulfanyl-2-fluoro-N-methylbenzamide |
| SMILES | CNC(=O)c1cccc(SNc2ccc(Cl)c3c(Cl)c[nH]c23)c1F |
| InChI | InChI=1S/C16H12Cl2FN3OS/c1-20-16(23)8-3-2-4-12(14(8)19)24-22-11-6-5-9(17)13-10(18)7-21-15(11)13/h2-7,21-22H,1H3,(H,20,23) |
| InChIKey | GBGXTHZCDCMOBP-UHFFFAOYSA-N |
| XLogP | 5.09 |
| TPSA | 56.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.26 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|