C17H15Cl2N3O2S — CID 164863473
N-[5-[(3,4-dichloro-1H-indol-7-yl)amino]sulfanyl-2-methoxyphenyl]acetamide (PubChem CID 164863473) has the molecular formula C17H15Cl2N3O2S and a molecular weight of 396.30 g/mol. Its IUPAC name is N-[5-[(3,4-dichloro-1H-indol-7-yl)amino]sulfanyl-2-methoxyphenyl]acetamide.
| Compound Name | N-[5-[(3,4-dichloro-1H-indol-7-yl)amino]sulfanyl-2-methoxyphenyl]acetamide |
|---|---|
| PubChem CID | 164863473 |
| Molecular Formula | C17H15Cl2N3O2S |
| Molecular Weight | 396.30 g/mol |
| Exact Mass | 395.03 |
| IUPAC Name | N-[5-[(3,4-dichloro-1H-indol-7-yl)amino]sulfanyl-2-methoxyphenyl]acetamide |
| SMILES | COc1ccc(SNc2ccc(Cl)c3c(Cl)c[nH]c23)cc1NC(C)=O |
| InChI | InChI=1S/C17H15Cl2N3O2S/c1-9(23)21-14-7-10(3-6-15(14)24-2)25-22-13-5-4-11(18)16-12(19)8-20-17(13)16/h3-8,20,22H,1-2H3,(H,21,23) |
| InChIKey | BRPWZTLHBGMCRI-UHFFFAOYSA-N |
| XLogP | 5.56 |
| TPSA | 66.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.30 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|