C19H20Cl2N2OS — CID 164877569
3,4-dichloro-N-[4-(3-methylbutoxy)phenyl]sulfanyl-1H-indol-7-amine (PubChem CID 164877569) has the molecular formula C19H20Cl2N2OS and a molecular weight of 395.36 g/mol. Its IUPAC name is 3,4-dichloro-N-[4-(3-methylbutoxy)phenyl]sulfanyl-1H-indol-7-amine.
| Compound Name | 3,4-dichloro-N-[4-(3-methylbutoxy)phenyl]sulfanyl-1H-indol-7-amine |
|---|---|
| PubChem CID | 164877569 |
| Molecular Formula | C19H20Cl2N2OS |
| Molecular Weight | 395.36 g/mol |
| Exact Mass | 394.07 |
| IUPAC Name | 3,4-dichloro-N-[4-(3-methylbutoxy)phenyl]sulfanyl-1H-indol-7-amine |
| SMILES | CC(C)CCOc1ccc(SNc2ccc(Cl)c3c(Cl)c[nH]c23)cc1 |
| InChI | InChI=1S/C19H20Cl2N2OS/c1-12(2)9-10-24-13-3-5-14(6-4-13)25-23-17-8-7-15(20)18-16(21)11-22-19(17)18/h3-8,11-12,22-23H,9-10H2,1-2H3 |
| InChIKey | CGHZKSIGEFYGPJ-UHFFFAOYSA-N |
| XLogP | 7.02 |
| TPSA | 37.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.36 |
| LogP ≤ 5 | 7.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|