C27H26Cl2FN3OS — CID 164877681
3,4-dichloro-N-[2-fluoro-4-[2-(4-piperidin-1-ylphenyl)ethoxy]phenyl]sulfanyl-1H-indol-7-amine (PubChem CID 164877681) has the molecular formula C27H26Cl2FN3OS and a molecular weight of 530.50 g/mol. Its IUPAC name is 3,4-dichloro-N-[2-fluoro-4-[2-(4-piperidin-1-ylphenyl)ethoxy]phenyl]sulfanyl-1H-indol-7-amine.
| Compound Name | 3,4-dichloro-N-[2-fluoro-4-[2-(4-piperidin-1-ylphenyl)ethoxy]phenyl]sulfanyl-1H-indol-7-amine |
|---|---|
| PubChem CID | 164877681 |
| Molecular Formula | C27H26Cl2FN3OS |
| Molecular Weight | 530.50 g/mol |
| Exact Mass | 529.12 |
| IUPAC Name | 3,4-dichloro-N-[2-fluoro-4-[2-(4-piperidin-1-ylphenyl)ethoxy]phenyl]sulfanyl-1H-indol-7-amine |
| SMILES | Fc1cc(OCCc2ccc(N3CCCCC3)cc2)ccc1SNc1ccc(Cl)c2c(Cl)c[nH]c12 |
| InChI | InChI=1S/C27H26Cl2FN3OS/c28-21-9-10-24(27-26(21)22(29)17-31-27)32-35-25-11-8-20(16-23(25)30)34-15-12-18-4-6-19(7-5-18)33-13-2-1-3-14-33/h4-11,16-17,31-32H,1-3,12-15H2 |
| InChIKey | XYZYJMKRUDGMRU-UHFFFAOYSA-N |
| XLogP | 8.34 |
| TPSA | 40.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.50 |
| LogP ≤ 5 | 8.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|