C21H25Cl2N3OS — CID 164877744
3,4-dichloro-N-[4-[6-(methylamino)hexoxy]phenyl]sulfanyl-1H-indol-7-amine (PubChem CID 164877744) has the molecular formula C21H25Cl2N3OS and a molecular weight of 438.42 g/mol. Its IUPAC name is 3,4-dichloro-N-[4-[6-(methylamino)hexoxy]phenyl]sulfanyl-1H-indol-7-amine.
| Compound Name | 3,4-dichloro-N-[4-[6-(methylamino)hexoxy]phenyl]sulfanyl-1H-indol-7-amine |
|---|---|
| PubChem CID | 164877744 |
| Molecular Formula | C21H25Cl2N3OS |
| Molecular Weight | 438.42 g/mol |
| Exact Mass | 437.11 |
| IUPAC Name | 3,4-dichloro-N-[4-[6-(methylamino)hexoxy]phenyl]sulfanyl-1H-indol-7-amine |
| SMILES | CNCCCCCCOc1ccc(SNc2ccc(Cl)c3c(Cl)c[nH]c23)cc1 |
| InChI | InChI=1S/C21H25Cl2N3OS/c1-24-12-4-2-3-5-13-27-15-6-8-16(9-7-15)28-26-19-11-10-17(22)20-18(23)14-25-21(19)20/h6-11,14,24-26H,2-5,12-13H2,1H3 |
| InChIKey | WEIGVUMAHFOOCJ-UHFFFAOYSA-N |
| XLogP | 6.75 |
| TPSA | 49.08 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.42 |
| LogP ≤ 5 | 6.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|