C22H21Cl2FN2O3S — CID 164877955
3,4-dichloro-N-[4-(1,4-dioxaspiro[4.5]decan-7-yloxy)-2-fluorophenyl]sulfanyl-1H-indol-7-amine (PubChem CID 164877955) has the molecular formula C22H21Cl2FN2O3S and a molecular weight of 483.39 g/mol. Its IUPAC name is 3,4-dichloro-N-[4-(1,4-dioxaspiro[4.5]decan-7-yloxy)-2-fluorophenyl]sulfanyl-1H-indol-7-amine.
| Compound Name | 3,4-dichloro-N-[4-(1,4-dioxaspiro[4.5]decan-7-yloxy)-2-fluorophenyl]sulfanyl-1H-indol-7-amine |
|---|---|
| PubChem CID | 164877955 |
| Molecular Formula | C22H21Cl2FN2O3S |
| Molecular Weight | 483.39 g/mol |
| Exact Mass | 482.06 |
| IUPAC Name | 3,4-dichloro-N-[4-(1,4-dioxaspiro[4.5]decan-7-yloxy)-2-fluorophenyl]sulfanyl-1H-indol-7-amine |
| SMILES | Fc1cc(OC2CCCC3(C2)OCCO3)ccc1SNc1ccc(Cl)c2c(Cl)c[nH]c12 |
| InChI | InChI=1S/C22H21Cl2FN2O3S/c23-15-4-5-18(21-20(15)16(24)12-26-21)27-31-19-6-3-13(10-17(19)25)30-14-2-1-7-22(11-14)28-8-9-29-22/h3-6,10,12,14,26-27H,1-2,7-9,11H2 |
| InChIKey | RSZRLWJEGKKDFA-UHFFFAOYSA-N |
| XLogP | 6.80 |
| TPSA | 55.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.39 |
| LogP ≤ 5 | 6.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|