C10H12ClNO3 — CID 91691937
N-(3-chloro-2,4-dimethoxyphenyl)acetamide (PubChem CID 91691937) has the molecular formula C10H12ClNO3 and a molecular weight of 229.66 g/mol. Its IUPAC name is N-(3-chloro-2,4-dimethoxyphenyl)acetamide.
| Compound Name | N-(3-chloro-2,4-dimethoxyphenyl)acetamide |
|---|---|
| PubChem CID | 91691937 |
| Molecular Formula | C10H12ClNO3 |
| Molecular Weight | 229.66 g/mol |
| Exact Mass | 229.05 |
| IUPAC Name | N-(3-chloro-2,4-dimethoxyphenyl)acetamide |
| SMILES | COc1ccc(NC(C)=O)c(OC)c1Cl |
| InChI | InChI=1S/C10H12ClNO3/c1-6(13)12-7-4-5-8(14-2)9(11)10(7)15-3/h4-5H,1-3H3,(H,12,13) |
| InChIKey | QMRQXZJLDCIEPQ-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.66 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |