C8H8BrClO2 — CID 53217015
1-bromo-3-chloro-2,4-dimethoxybenzene (PubChem CID 53217015) has the molecular formula C8H8BrClO2 and a molecular weight of 251.51 g/mol. Its IUPAC name is 1-bromo-3-chloro-2,4-dimethoxybenzene.
| Compound Name | 1-bromo-3-chloro-2,4-dimethoxybenzene |
|---|---|
| PubChem CID | 53217015 |
| Molecular Formula | C8H8BrClO2 |
| Molecular Weight | 251.51 g/mol |
| Exact Mass | 249.94 |
| IUPAC Name | 1-bromo-3-chloro-2,4-dimethoxybenzene |
| SMILES | COc1ccc(Br)c(OC)c1Cl |
| InChI | InChI=1S/C8H8BrClO2/c1-11-6-4-3-5(9)8(12-2)7(6)10/h3-4H,1-2H3 |
| InChIKey | UWFOXBKVWIZPQJ-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.51 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |