C15H14Br2ClNO2 — CID 107950937
(3-chloro-2,4-dimethoxyphenyl)-(2,4-dibromophenyl)methanamine (PubChem CID 107950937) has the molecular formula C15H14Br2ClNO2 and a molecular weight of 435.54 g/mol. Its IUPAC name is (3-chloro-2,4-dimethoxyphenyl)-(2,4-dibromophenyl)methanamine.
| Compound Name | (3-chloro-2,4-dimethoxyphenyl)-(2,4-dibromophenyl)methanamine |
|---|---|
| PubChem CID | 107950937 |
| Molecular Formula | C15H14Br2ClNO2 |
| Molecular Weight | 435.54 g/mol |
| Exact Mass | 432.91 |
| IUPAC Name | (3-chloro-2,4-dimethoxyphenyl)-(2,4-dibromophenyl)methanamine |
| SMILES | COc1ccc(C(N)c2ccc(Br)cc2Br)c(OC)c1Cl |
| InChI | InChI=1S/C15H14Br2ClNO2/c1-20-12-6-5-10(15(21-2)13(12)18)14(19)9-4-3-8(16)7-11(9)17/h3-7,14H,19H2,1-2H3 |
| InChIKey | RVDJYJAWUKFAEG-UHFFFAOYSA-N |
| XLogP | 4.93 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.54 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |