C16H17Br2NO2 — CID 107950473
(2,4-dibromophenyl)-(4,5-dimethoxy-2-methylphenyl)methanamine (PubChem CID 107950473) has the molecular formula C16H17Br2NO2 and a molecular weight of 415.13 g/mol. Its IUPAC name is (2,4-dibromophenyl)-(4,5-dimethoxy-2-methylphenyl)methanamine.
| Compound Name | (2,4-dibromophenyl)-(4,5-dimethoxy-2-methylphenyl)methanamine |
|---|---|
| PubChem CID | 107950473 |
| Molecular Formula | C16H17Br2NO2 |
| Molecular Weight | 415.13 g/mol |
| Exact Mass | 412.96 |
| IUPAC Name | (2,4-dibromophenyl)-(4,5-dimethoxy-2-methylphenyl)methanamine |
| SMILES | COc1cc(C)c(C(N)c2ccc(Br)cc2Br)cc1OC |
| InChI | InChI=1S/C16H17Br2NO2/c1-9-6-14(20-2)15(21-3)8-12(9)16(19)11-5-4-10(17)7-13(11)18/h4-8,16H,19H2,1-3H3 |
| InChIKey | FNWHAQHHYWHUJQ-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.13 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |