C14H12Br3NO — CID 107950477
(2-bromo-4-methoxyphenyl)-(2,4-dibromophenyl)methanamine (PubChem CID 107950477) has the molecular formula C14H12Br3NO and a molecular weight of 449.97 g/mol. Its IUPAC name is (2-bromo-4-methoxyphenyl)-(2,4-dibromophenyl)methanamine.
| Compound Name | (2-bromo-4-methoxyphenyl)-(2,4-dibromophenyl)methanamine |
|---|---|
| PubChem CID | 107950477 |
| Molecular Formula | C14H12Br3NO |
| Molecular Weight | 449.97 g/mol |
| Exact Mass | 446.85 |
| IUPAC Name | (2-bromo-4-methoxyphenyl)-(2,4-dibromophenyl)methanamine |
| SMILES | COc1ccc(C(N)c2ccc(Br)cc2Br)c(Br)c1 |
| InChI | InChI=1S/C14H12Br3NO/c1-19-9-3-5-11(13(17)7-9)14(18)10-4-2-8(15)6-12(10)16/h2-7,14H,18H2,1H3 |
| InChIKey | GLDUDWQHKDVMDO-UHFFFAOYSA-N |
| XLogP | 5.03 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.97 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |