C9H13BrN2O — CID 126973068
1-(2-bromo-4-methoxyphenyl)ethane-1,2-diamine (PubChem CID 126973068) has the molecular formula C9H13BrN2O and a molecular weight of 245.12 g/mol. Its IUPAC name is 1-(2-bromo-4-methoxyphenyl)ethane-1,2-diamine.
| Compound Name | 1-(2-bromo-4-methoxyphenyl)ethane-1,2-diamine |
|---|---|
| PubChem CID | 126973068 |
| Molecular Formula | C9H13BrN2O |
| Molecular Weight | 245.12 g/mol |
| Exact Mass | 244.02 |
| IUPAC Name | 1-(2-bromo-4-methoxyphenyl)ethane-1,2-diamine |
| SMILES | COc1ccc(C(N)CN)c(Br)c1 |
| InChI | InChI=1S/C9H13BrN2O/c1-13-6-2-3-7(8(10)4-6)9(12)5-11/h2-4,9H,5,11-12H2,1H3 |
| InChIKey | DYRHPNKRYANIGU-UHFFFAOYSA-N |
| XLogP | 1.42 |
| TPSA | 61.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.12 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |