C15H14Br3NO2 — CID 114368828
(2-bromo-4,5-dimethoxyphenyl)-(2,5-dibromophenyl)methanamine (PubChem CID 114368828) has the molecular formula C15H14Br3NO2 and a molecular weight of 479.99 g/mol. Its IUPAC name is (2-bromo-4,5-dimethoxyphenyl)-(2,5-dibromophenyl)methanamine.
| Compound Name | (2-bromo-4,5-dimethoxyphenyl)-(2,5-dibromophenyl)methanamine |
|---|---|
| PubChem CID | 114368828 |
| Molecular Formula | C15H14Br3NO2 |
| Molecular Weight | 479.99 g/mol |
| Exact Mass | 476.86 |
| IUPAC Name | (2-bromo-4,5-dimethoxyphenyl)-(2,5-dibromophenyl)methanamine |
| SMILES | COc1cc(Br)c(C(N)c2cc(Br)ccc2Br)cc1OC |
| InChI | InChI=1S/C15H14Br3NO2/c1-20-13-6-10(12(18)7-14(13)21-2)15(19)9-5-8(16)3-4-11(9)17/h3-7,15H,19H2,1-2H3 |
| InChIKey | ACJKSSIQFRRSSR-UHFFFAOYSA-N |
| XLogP | 5.04 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.99 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |