C13H13Br2NO2S — CID 63796861
(2-bromo-4,5-dimethoxyphenyl)-(3-bromothiophen-2-yl)methanamine (PubChem CID 63796861) has the molecular formula C13H13Br2NO2S and a molecular weight of 407.13 g/mol. Its IUPAC name is (2-bromo-4,5-dimethoxyphenyl)-(3-bromothiophen-2-yl)methanamine.
| Compound Name | (2-bromo-4,5-dimethoxyphenyl)-(3-bromothiophen-2-yl)methanamine |
|---|---|
| PubChem CID | 63796861 |
| Molecular Formula | C13H13Br2NO2S |
| Molecular Weight | 407.13 g/mol |
| Exact Mass | 404.90 |
| IUPAC Name | (2-bromo-4,5-dimethoxyphenyl)-(3-bromothiophen-2-yl)methanamine |
| SMILES | COc1cc(Br)c(C(N)c2sccc2Br)cc1OC |
| InChI | InChI=1S/C13H13Br2NO2S/c1-17-10-5-7(9(15)6-11(10)18-2)12(16)13-8(14)3-4-19-13/h3-6,12H,16H2,1-2H3 |
| InChIKey | DGINVOPKQSYBKS-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.13 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |